1. 재질: 소나무 + 토끼털 + 솜털 + 고무
2. 크기: 구름형: 28x21cm, 다섯 구멍형: 33.5x26x10cm, 여덟 구멍형: 40x33.5x10cm
3. 적용 대상: 고양이
4. 특징: 시뮬레이션 쥐, 사람과 반려동물 상호작용, 토끼털 공 디자인
5. 손잡이는 숨겨진 기술을 암시하며, 슬롯 디자인으로 캣닢 추가 가능
6. 과학적 설계, 지능 향상

1. 재질: 나무, 금속, 플라스틱
2. 용도: 햄스터, 새, 토끼 등
3. 9개 세트 구성: 솔방울 x2, 네모난 나무 x2, 링 x1, 그네 x1, 사과 가지 x1 가방, 작은 아령 x1, 수박 공 x1
4. 10개 세트 구성: 터널 x1, 긴 끈 x1, 솔방울 x2, 네모난 나무 x2, 링 x1, 그네 x1, 사과 가지 x1 가방, 작은 꽃 드럼 x1
5. 11개 세트 구성: 플라스틱 공 x2, 실 공 x1, 솔방울 x2, 네모난 나무 x2, 작은 꽃 드럼 x1, 링 x1, 그네 x1, 사과 가지 x1 패키지
6. 12개 세트 구성: 터널 x1, 긴 끈 x1, 솔방울 x2, 네모난 나무 x2, 작은 꽃 드럼 x1, 링 x1, 그네 x1, 사과 가지 x1 가방, 작은 아령 x1, 작은 바퀴 x1
7. 15개 세트 구성: 터널 x1, 긴 끈 x1, 솔방울 x2, 네모난 나무 x2, 작은 꽃 드럼 x1, 링 x1, 그네 x1, 사과 가지 x1 가방, 작은 아령 x1, 작은 바퀴 x1, 큰 아령 x1, 큰 허브 x1, 수박 공 x1
8. 무게: 9개 세트 약 156그램, 10개 세트 약 340그램, 11개 세트 약 148그램, 12개 세트 약 365그램, 15개 세트 약 446그램

특징
1. 야외 스포츠, 지아밍 플로우 외관.
2. 1.6인치 초고화질 대형 화면, 초슬림 베젤, 원형 화면 스타일에 최적의 화면 선택, 최고의 외관과 촉감 수준. 킹 판다 글래스, 고강도, 내마모 및 긁힘 방지.
3. 정품 알리페이 오프라인 결제.
4. 나침반.
5. 100+ 스포츠 모드.
6. HD 블루투스 통화, 한 번 연결.
7. 340mAh 대용량 배터리, 강력한 배터리 수명.
8. 다이얼 마켓.
9. 동적 심박, 달리기 시에도 정확한 측정 가능.
11. 저전력 진정 혈중 산소, 검증 가능 (숨 참기 혈중 산소 수치 하락).
12. 진정한 IP67 방수, 실제 1미터 수심 30분, 판매 후 거의 침수 문제 없음.

제품 사양
1. CPU: Jerry II JL7012A6
2. 내장 저장소: 640KB
3. 외장 확장 플래시: 128Mb
4. 디스플레이: 1.6인치 풀 서클 풀 컬러 풀 뷰 TFT; 해상도: 400*400;
5. 터치 스크린: 판다 고알루미늄 글래스 커버; 정전식 풀 터치 스크린; 풀 라미네이션
6. 블루투스: BLE Ver5.1 및 BT3.0 듀얼 모드
7. 심박 센서: 동적 심박 지원, HRS3605, 36단계 흑피 측정;
8. 혈중 산소 센서: 지원
9. 배터리: 340mAh 폴리머 리튬이온 배터리; 순수 코발트, 세이코 보호 회로
10. 배터리 수명: 블루투스 연결 대기: 약 30일; 일반 사용: 7~10일.
11. 만보계: 지원
12. 모터: 지원
13. 마이크: 지원
14. 스피커: 지원
15. 버튼: 전원 버튼 & 기능 버튼
16. 나침반: 지원
17. 충전 방식: 자석 충전 케이블; DC5V--300mA
18. 방진 및 방수 등급: 진정한 IP67 (1미터 수심, 30분)
19. 정전기 보호 수준: 접촉 4KV, 공기 8KV
20. 주요 기능:
21. 다중 다이얼 전환: 지원, 동적 다이얼
22. 다중 UI 스타일 전환: 지원
23. 다이얼 마켓: 지원
24. 모바일 앱 메시지 알림: SMS, QQ, 위챗, 트위터, 페이스북, 링크드인, 스카이프, 왓츠앱, 라인, 바이버, 인스타그램 등 실시간 메시지 지원
25. 통화 알림: 지원
26. 블루투스 통화: 지원
27. 알리페이 오프라인 결제: 지원
28. 나침반: 지원
29. 기상 데이터: 자외선, 기압, 풍속, 습도, 날씨 지원
30. 음성 비서: 지원
31. 블루투스 음악 제어: 지원
32. 심박수 모니터링: 지원
33. 혈중 산소 모니터링: 지원
34. 스트레스 지수: 지원
35. 생리 주기: 지원
36. 만보기: 지원
37. 수면 모니터링: 지원
38. 마음챙김 (호흡 안내): 지원
39. 다중 스포츠 모드: 걷기, 달리기, 자전거 타기, 등산, 배드민턴, 농구, 탁구, 줄넘기, 요가 등 100개 이상의 스포츠 모드 지원
40. 좌식 알림: 지원
41. 펌웨어 다국어: 영어, 간체 중국어, 러시아어, 스페인어, 독일어, 이탈리아어, 프랑스어, 포르투갈어, 폴란드어, 네덜란드어, 터키어, 루마니아어, 히브리어, 덴마크어, 스웨덴어, 체코어, 중국어 포함 20개 언어, 헝가리어, 아랍어, 태국어, 페르시아어.
42. 기타 기능: 미니 게임, 내 QR 코드, 알람 시계, 스톱워치, 카운트다운, 방해 금지 모드, 손목 들어 화면 밝히기, 휴대폰 찾기, 원격 카메라 제어, 계산기, 손전등, 달력 등.
43. 앱: Fundo health
44. 스마트폰 시스템 지원: Android 7 이상, IOS9.0 이상.

외관
1. 제품 크기: 지름 47.5mm x 두께 13.5mm
2. 외관 처리: 판다 유리 커버 + 진공 전기 아연 도금 티타늄 합금 & 304 스테인리스 스틸 + 플라스틱 하단 케이스 & 아크릴 렌즈 + 표준 액체 실리콘 스트랩
3. 무게: 52g

1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz
2. OS System: RTOS
3. Memory: ROM 128MB + RAM 48MB
4. Storage Extend: TF card up to 64GB (not included)
5. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
6. Charge Port: Type-C
7. Battery: 2000mAh li-ion removable battery
8. Features: FM Radio, SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 146.2x65.4x17mm
12. Weight: 390g

Display Screen:
1. Size: 2.8 inch QVGA TFT screen
2. Screen resolution: 320 x 240 px

Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
(Note: Different versions correspond to different frequency bands)

Languages:
1. EU Version: English, Chinese, Arabic, Portuguese, Russian, Greek, French, Italian, Turkish, Spanish, German, Hebrew, Czech, Dutch, Albanian, Bulgarian, Croatian, Danish, Finnish, Macedonian , Norwegian, Polish, Serbian, Swedish, Hungarian
2. US Version: Chinese, English, Portuguese, French, Spanish, Dutch
(Note: Different versions have different corresponding languages.)

Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide(In 6 languages ??(English, German, Greek, Polish, Russian, Hungarian)) x 1
6. Lock-pin x 1

1. CPU: UNISOC SC9832E, ARM Cortex-A53, quad-core, 1.4GHz
2. OS System: Android 11 (Fixed version, no upgrade available.)
3. Memory: ROM 32GB + RAM 3GB
4. Storage Extend: TF card up to 128GB (not included)
5. Card Type: SIM1-Nano SIM, SIM2-Nano SIM
6. Charge Port: Type-C; Audio Jack: 3.5 mm
7. Battery: 3000mAh li-ion removable battery
8. Features: FM Radio, SOS, torch, VoLTE
9. BT: V4.2
10. Camera: Rear 5MP; Front: 2MP
11. Size: 143.0 x 63.5 x 17.5mm
12. Weight: 173g with battery

Display Screen:
1. Size: 2.83 inch VGA IPS screen
2. Screen resolution: 480 x 640 px

Network Bands:
1. 4G: FDD- LTE B1/2/3/4/5/7/8/12/17/20/25/26/28/66
2. 3G: WCDMA B1/B2/B4/B5/B8
3. 2G: GSM B2/B3/B5/B8

Languages:
Indonesian, Malay, Catalan, Czech, Danish, German, Estonian, English, Spanish, Filipino, French, Croatian, Italian, Latvian, Lithuanian, Hungarian, Dutch, Norwegian, Polish, Portuguese, Romanian, Slovak, Finnish, Swedish, Vietnamese, Greek, Turkish, Bulgarian, Russian, Serb, Ukrainian, Armenian, Hebrew, Urdu, Arabic, Persian, Hindi, Bengali, Thai, Korean, Burmese, Japanese, Simplified Chinese, Traditional Chinese

Package List:
1. Phone x 1
2. Quick user guide x 1
3. USB cable x 1
4. Warranty card x 1

1. Lightweight and portable.
2. Made of high quality material, durable and firm.
3. Support over-temperature, over-current protection, over-voltage and short-circuit protection.
4. Qi wireless charging standard: easy to use.
5. Creative dual coil design.
6. Intelligent and safe for charging.
7. Fast charging input: 9V 1.67A; Common charging input: 5V 2A
8. Fast charging output: 9V 1.1A; Common charging output: 5V 1A
9. Working distance: within 8mm.
10. Compatible with most Qi standard mobile phones.
11. With hidden cooling holes design, effectively for heat dissipation.
12. For Huawei,Xiaomi Ulefone,Doogee,UMIDIGI,AGM phones

1. CPU: T107, ARM CortexTM A7, quad-core, 1.0GHz
2. Memory: ROM 128MB + RAM 48MB
3. Storage Extend: TF card up to 64GB (not included)
4. Card Type: SIM1 + mircro SIM, SIM2 + mircro SIM
5. Charge Port: Type-C
6. Headphone Jack: 3.5mm
7. Battery: 1500mAh li-ion removable battery
8. Features: FM Radio, OTG (reverse charging), SOS, torch, VoLTE
9. BT: V2.1
10. Camera: Rear 0.3MP
11. Size: 107.3 x 56.2 x 20.3mm

Display Screen:
1. Size: 2.8 inch inner screen, 1.77 inch outer screen
2. Screen resolution: 240 x 320 px inner screen,160 x 128px outer screen

Network Bands:
EU Version:
1. 4G: FDD- LTE B1/B3/B7/B8/B20(2100/1800/2600/900/800MHz)
2. 3G: WCDMA B5/B8/B1(850/900/2100MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)
US Version:
1. 4G: FDD- LTE B2/B4/B5/B7/B12/B17/B28/B66(1900/1700/850/2600/700/700/700/1700MHz)
2. 3G: WCDMA B2/B5/B4(1900/850/1700MHz)
3. 2G: GSM B5/B8/B3/B2(850/900/1800/1900MHz)

Languages:
1. European languages: Finnish, Swedish, Norwegian, Icelandic, Danish, Spanish, Portuguese, Italian, Greek, Slovenian, Croatian, Romanian, Bulgarian, Serbian, English, French, Irish , Dutch, German, Swiss, Polish, Czech, Hungarian, Slovak, Estonian, Latvian, Lithuanian, Russian
2. US language: Costa Rican, Cuban, Honduran, Canadian English, US English, Mexican, Dominican, Grenadian, Haitian, Nicaraguan, Salvadoran, Saint Kitts and Nevis, Saint Lucia English, Saint Vincent and the Grenadines, Trinidad and Tobago, Guatemalan, Jamaican

Package List:
1. Phone x 1
2. Power charger x 1
3. USB cable x 1
4. Warranty card x 1
5. Quick user Guide x 1

1. Material: high borosilicate glass
2. The pot body is thick and can avoid direct contact between hands and high temperature
3. Can withstand instantaneous temperature difference of -20 to 150 degrees celsius
4. V-shaped spout, high safety
5. The cup body has a scale line, so you can easily see the content capacity
6. Weight: about 350 grams
7. Size: 6x10x16.5 cm

Item Type:Hook Needle
Description:
1. Specifications: 1-1 model (1 hair per hook); 1-2 models (1-2 hairs per hook); 2-3 models (2-3 hairs per hook); 3-4 Model number (3-4 hairs per hook)
2. Placement: when not in use for a long time, it is best to touch the sewing machine oil to avoid the use of rust!
3. Note: please keep out of reach of children to avoid stab!
4. Function: this is great for beginners or to learn to ventilate lace wigs. You can customize your lace wig hair and easily repair lace wigs.
5. Features: this simple venting needle has a beautiful bronze hook end to prevent hair loss. It is easier to use than traditional German or Asian vent needles and is easy to grasp.

1. Material: ABS+stainless steel blade
2. Small and easy to store
3. Easy exchange of blades
4. The incision is even and flat
5. Widened design, easy to press
6. The lever is easily pressed, and the wire is out of the film
7. Transparent container, can clean food directly
8. Protect hands, thorns at the bottom, stabilize food
9. The bottom silicone pad is stable, wear-resistant and non-slip
10. Unit weight: 0.574kg
11. Size: 9.5x28.5cm

1. Use healthy and durable stainless steel with good anti-rust performance,
Let you drink more at ease.
2. The inside of the pot is polished by point solution, and the outside of the pot is made of bright surface, which is bright and easy to clean.
3. The personalized handle conforms to ergonomic principles, has a comfortable grip, high temperature resistance, low thermal conductivity, and effective heat insulation and anti-scalding.
4. Long-mouth spout design, convenient for water injection and more characteristic
5. The thick ring-shaped round surface and the flat bottom are heated evenly and quickly, and it is special for induction cooker, which saves energy and time.
6. Reserved air vents on the lid to prevent excessive boiling, intimate and humanized design, safe to use
7. Weight: 0.8L: 250g, 1.0L: 280g

Feature:
1. Three levels of wind volume: weak wind>natural wind>strong wind. The wind on the left and right sides is even.
2. No wing design, you dont have to worry about your hair being caught by the fan blades.
3. Equipped with 2600 mAh battery, brand new upgrade, continuous use time can reach 8-18 hours (depending on speed)
4. The neck fan has 46 ventilation holes to keep the face cool and keep makeup. A 360-degree refreshing experience, safe for children and adults to use.
5. Packing list:
1x hands-free personal fan
1x USB charging cable
1x user manual

1. Mini and compact, can be held or stood, easy to carry
2. Three-speed wind adjustment, turbine airflow, 360-degree global wind
3. Low wind noise, low noise, quiet and not annoying
4. Turbine blades, powerful silent movement
5. Large-capacity battery, long-lasting battery life
6. Battery capacity: 500mAh
7. Power supply mode: USB charging
8. Charging time: about 3h
9. Working time: 1-3h
10. Dimensions: about 12.5 x 4.2 x 5.8cm
11. Weight: about 83.4g

Material:Beech
Type:Cup
Description:
1. Unit weight: about 0.2 kg
2. Size: total length 15 cm, mouth width 8 cm, height 6 cm
3. Capacity: 101-200 ml
4. Packing: opp bag
5. Function: environmental protection
6. Style: creative

1. Lightweight and portable, comfortable to hold and easy to use
2. Visual storage bin design, fine powder
3. Ceramic grinding core, the thickness can be adjusted by rotating left and right
4. Splash-proof silicone cover, large storage capacity, dust-proof and safer
5. Material: ceramic, ABS
6. Size: about 20 x 8.2cm
7. Weight: about 277g

1. This high-performance 3D printing pen kit is designed for children to create 3D artwork and models. It supports PLA/ABS filaments and features a user-friendly design with multiple safety upgrades, making it ideal for fostering creativity and hands-on learning.
2. Adjustable Settings: LED screen displays real-time temperature (160~230 degrees Celsius). Switch between PLA/ABS modes and control speed via a sliding button.
3. Safety Upgrades: Embedded nozzle design minimizes accidental contact; includes finger guards for added protection.
4. One-Touch Operation: Simplifies filament feeding/retraction, suitable for kids.
5. Nozzle diameter: 0.7mm
6. Filament Diameter: 1.75mm
7. Power adapter: 100 - 240V
8. Complete set of accessories: Includes pen, power adapter, base, scissors, finger cover, unclogging needle, drawing board, drawing album, and 20-color PLA materials (single color 5 meters, total 100 meters).

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

About the product
1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image
4. Make a wonderful gift for creative children and adults
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others
8. Spinning speed is adjustable
9. Intelligent standby function can really avoid unnecessary damage and save the electricity

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

1. The 3D Printing Pen is the newest concept in the field of three dimensional design, crafting and art.
2. When you draw an object with the 3D printing pen, it emits heated plastic, which will be instantly cooled and solidified into a sturdy structure.
3. This 3D evolutionary gadget in the art of 3D creation will help you create whatever you can image.
4. Make a wonderful gift for creative children and adults.
5. You can use this pen to draw your desired letter, shape, figure etc. by using its ABS filament.
6. Suitable for painting worker, product designer, hobbyist, children, student, etc.
7. Light-weight design can offer you more comfortable experience than the others.
8. Spinning speed is adjustable.
9. Intelligent standby function can really avoid unnecessary damage and save the electricity.

Item type: Cleaning brush
Usage: Bathroom, kitchen
Material: Plastic
Size: 32x10cm
Package content: 1 x cleaning brush

1. Outdoor air condition.
2. Good gift for children and girl.
3. Power: USB powered.
4. There is a chargeable lithium battery inside, charging for 5 hours, the battery will be full, it can keep working for 1 hours, the machine has a USB charge line as a accessory.
5. The machine has two operating mode, freezing and natural air.
- Freezing mode: It is high technology by evaporating and freezing water. Make the sponge wet, put it in the sponge reserving zone of the behind of machine. State up the power, it can make the cool air.
- Natural air mode: Take out of the sponge, turn the power on will achieving the natural air.
6. This machine is not waterproof, so when you wet the sponge, please take it out, it is prevent from wet the machine to burn it out.

1. Name: folding Mirror
2. Size: 70mm mirror body, 58mm mirror surface, 10mm mirror thickness
3. Weight: about 85g
4. Compact and portable
5. It can be opened with one button for easy use
6. Good gifts for ladies

1. Material: PP
2. Anti-slip hand protection, faster washing and less effort in decontamination
3. Washing underwear separately is more hygienic and thorough.
4. There is a card slot design at the bottom for more secure placement.
5. Suitable for all kinds of small clothes to meet your various cleaning requirements
6. The separate handle can hold washing powder
7. Compact shape, freely placed anywhere
8. Suspended design, easy to carry and does not take up space
9. Can be soaked, rubbed and lifted easily, smooth and will not damage clothes
10. Dimensions: 32x18x7.5 cm

1. 9개의 실리콘 드럼 패드가 있는 휴대용 전자 드럼으로, 탐(3개) / 스네어 / 베이스 드럼, 하이햇 / 크래시(2개) / 라이드 심벌을 포함하며, 뛰어난 사운드와 실제 타격 효과를 시뮬레이션할 수 있습니다.
2. 12개의 데모 곡, 7가지 드럼 사운드, 9가지 반주 리듬으로 다양한 선택이 가능해 드럼 연습이 더 쉬워집니다.
3. 내장 스테레오 스피커로 자유롭게 사운드를 즐길 수 있으며, 3.5mm 오디오 출력 잭으로 이어폰 또는 외부 스피커 연결 가능, 3.5mm 오디오 입력 잭으로 MP3/스마트폰/태블릿 컴퓨터 연결하여 반주 음악 재생 가능.
4. 1000mA 리튬 배터리 내장, 녹음 및 재생 기능 지원; 9단계 볼륨 조절 및 15단계 데모 곡/반주 재생 속도 조절, 유연한 조작.
5. 색상: 다색
6. 재질: 실리콘 + 플라스틱
7. 데모 곡: 12
8. 드럼: 7
9. 반주: 9
10. 전원 공급: 1000mA 리튬 배터리 또는 DC 5V 1000mA 전원 어댑터
11. 제품 사양: 48 x 32 x 5cm / 18.9 x 12.6 x 2인치
12. 무게: 920그램 / 2파운드
13. 패키지 목록:
1 x 전자 드럼
2 x 드럼 스틱
2 x 서스테인 페달
1 x USB 전원 코드
1 x 전원 어댑터
1 x 3.5mm 오디오 케이블
1 x 사용자 설명서 (중국어 및 영어)